| Name | Ethylhippurate |
| Synonyms | Ethylhippurate ETHYL HIPPURATE ethyl N-benzoylglycinate BENZOYLGLYCINE ETHYL ESTER Ethyl (benzoylamino)acetate ETHYL 2-(BENZOYLAMINO)ACETATE ethyl 2-(phenylcarbonylamino)ethanoate 2-(benzoylamino)acetic acid ethyl ester Benzoic amide, N-(ethoxycarbonyl)methyl- |
| CAS | 1499-53-2 |
| InChI | InChI=1/C11H13NO3/c1-2-15-10(13)8-12-11(14)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,12,14) |
| Molecular Formula | C11H13NO3 |
| Molar Mass | 207.23 |
| Density | 1.133±0.06 g/cm3(Predicted) |
| Melting Point | 58-60°C |
| Boling Point | 391.1±25.0 °C(Predicted) |
| Flash Point | 190.3°C |
| Vapor Presure | 2.52E-06mmHg at 25°C |
| pKa | 13.14±0.46(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.519 |
| MDL | MFCD00026890 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |